cas: 830-96-6 — see every product listed under this CAS number, including other names
3-Indolepropionic acid, 99.92% (CAS 830-96-6) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 10mM/1mL, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W015229-10 g |
| cas | 830-96-6 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 310.40 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 5 g | 263.96 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.92% |
3-(1H-indol-3-yl)propanoic acid is an indol-3-yl carboxylic acid that is propionic acid substituted by a 1H-indol-3-yl group at position 3. It has a role as an auxin, a plant metabolite and a human metabolite. It is functionally related to a propionic acid. It is a conjugate acid of a 3-(1H-indol-3-yl)propanoate.
Source: ChEBI
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)propanoic acid |
| InChIKey | GOLXRNDWAUTYKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCC(=O)O |
Computed by PubChem (NCBI)