3-Iodo-4-nitrophenol, 97%
cas: 50590-07-3 — see every product listed under this CAS number, including other names
3-Iodo-4-nitrophenol, 97% (CAS 50590-07-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A116206-250mg |
| cas | 50590-07-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 898.81 Pln | |
| Ambeed | 25g | 1922.31 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 519.84 Pln | |
| BLDpharm | 10g | 964.13 Pln | |
| BLDpharm | 25g | 2069.30 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-iodo-4-nitrophenol (CAS 50590-07-3) is a chemical compound with the molecular formula C6H4INO3 and a molecular weight of 265.01 g/mol. IUPAC name: 3-iodo-4-nitrophenol. InChIKey: FIWCMSJAIDKMNX-UHFFFAOYSA-N.
| Molecular formula | C6H4INO3 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 3-iodo-4-nitrophenol |
| InChIKey | FIWCMSJAIDKMNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
3-Iodo-4-nitrophenol, Phenol, 3-iodo-4-nitro-