cas: 201286-95-5 — see every product listed under this CAS number, including other names
3-Methyl-1H-indazole-6-carboxylic acid methyl ester, 97%, 97% (CAS 201286-95-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BI3E-100mg |
| cas | 201286-95-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 861.20 Pln | |
| Chemat | 5g | 2464.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-methyl-2H-indazole-6-carboxylate (CAS 201286-95-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 3-methyl-2H-indazole-6-carboxylate. InChIKey: CKPSQUXIPHAGLQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 3-methyl-2H-indazole-6-carboxylate |
| InChIKey | CKPSQUXIPHAGLQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1)C(=O)OC |
Computed by PubChem (NCBI)