cas: 201286-95-5 — see every product listed under this CAS number, including other names
Methyl 3-methyl-2H-indazole-6-carboxylate 97% (CAS 201286-95-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A644633-100mg |
| cas | 201286-95-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1405.00 Pln | |
| Ambeed | 5g | 4748.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A644633 |
Methyl 3-methyl-2H-indazole-6-carboxylate (CAS 201286-95-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 3-methyl-2H-indazole-6-carboxylate. InChIKey: CKPSQUXIPHAGLQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 3-methyl-2H-indazole-6-carboxylate |
| InChIKey | CKPSQUXIPHAGLQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1)C(=O)OC |
Computed by PubChem (NCBI)