cas: 201286-95-5 — see every product listed under this CAS number, including other names
methyl 3-methyl-1H-indazole-6-carboxylate, 98% (CAS 201286-95-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F811994-100MG |
| cas | 201286-95-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 3371.75 Pln | |
| Fluorochem | 10g | 5558.48 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-methyl-2H-indazole-6-carboxylate (CAS 201286-95-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 3-methyl-2H-indazole-6-carboxylate. InChIKey: CKPSQUXIPHAGLQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 3-methyl-2H-indazole-6-carboxylate |
| InChIKey | CKPSQUXIPHAGLQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1)C(=O)OC |
Computed by PubChem (NCBI)