cas: 63770-48-9 — see every product listed under this CAS number, including other names
3-Methyl-5-nitrobenzo[d]isoxazole, 97% (CAS 63770-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F606033-100MG |
| cas | 63770-48-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 1g | 1815.00 Pln | |
| Fluorochem | 5g | 3814.30 Pln | |
| Fluorochem | 10g | 6443.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-methyl-5-nitro-1,2-benzoxazole (CAS 63770-48-9) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-methyl-5-nitro-1,2-benzoxazole. InChIKey: PQLIRZDJBWDLOU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-methyl-5-nitro-1,2-benzoxazole |
| InChIKey | PQLIRZDJBWDLOU-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)