cas: 102266-15-9 — see every product listed under this CAS number, including other names
3-Nitro-6-phenylpyridin-2-amine, 97% (CAS 102266-15-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F340386-50MG |
| cas | 102266-15-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 794.53 Pln | |
| Fluorochem | 100mg | 1278.73 Pln | |
| Fluorochem | 250mg | 2096.15 Pln | |
| Fluorochem | 1g | 4131.90 Pln | |
| Fluorochem | 5g | 12280.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-nitro-6-phenylpyridin-2-amine (CAS 102266-15-9) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 3-nitro-6-phenylpyridin-2-amine. InChIKey: XBWMSLRYGXSAKH-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 3-nitro-6-phenylpyridin-2-amine |
| InChIKey | XBWMSLRYGXSAKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)