cas: 618-94-0 — see every product listed under this CAS number, including other names
3-Nitrobenzhydrazide, 98%, 98% (CAS 618-94-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JT6-5g |
| cas | 618-94-0 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 179.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-nitrobenzohydrazide (CAS 618-94-0) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 3-nitrobenzohydrazide. InChIKey: NQEWXLVDAVTOHM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-nitrobenzohydrazide |
| InChIKey | NQEWXLVDAVTOHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NN |
Computed by PubChem (NCBI)