CAS 2221-13-8 appears in our catalog under these names: 3–Phenylimidazolidine–2,4–dione, 3-Phenylhydantoin, 95% , 3-Phenyl-imidazolidine-2,4-dione, 3-Phenylimidazolidine-2,4-dione 95%, 3-Phenylimidazolidine-2,4-dione, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
3-phenylimidazolidine-2,4-dione (CAS 2221-13-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-phenylimidazolidine-2,4-dione. InChIKey: RUEGAVIENIPHGK-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-phenylimidazolidine-2,4-dione |
| InChIKey | RUEGAVIENIPHGK-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)