CAS 32502-63-9 appears in our catalog under these names: 3–Phenyltoxoflavin, 3-Phenyltoxoflavin/ 98.84% (existing batch purity), 1,6-DIMETHYL-3-PHENYLPYRIMIDO[5,4-E]-1,2,4-TRIAZINE-5,7(1H,6H)-DIONE, 98%, 98%, 3-Phenyltoxoflavin, 99.76%, 3-Phenyltoxoflavin, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 2mg.
1,6-dimethyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (CAS 32502-63-9) is a chemical compound with the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. IUPAC name: 1,6-dimethyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione. InChIKey: SFOMBJIIZPCRJH-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O2 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 1,6-dimethyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| InChIKey | SFOMBJIIZPCRJH-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)