cas: 16837-38-0 — see every product listed under this CAS number, including other names
3-Pyridinecarboxylic Anhydride, >97.0%(GC)(T) (CAS 16837-38-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P1768-1G |
| cas | 16837-38-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 260.95 Pln | |
| TCI | 5g | 1224.73 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC)(T) |
Pyridine-3-carbonyl pyridine-3-carboxylate (CAS 16837-38-0) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: pyridine-3-carbonyl pyridine-3-carboxylate. InChIKey: VPODXHOUBDCEHN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | pyridine-3-carbonyl pyridine-3-carboxylate |
| InChIKey | VPODXHOUBDCEHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)