cas: 16837-38-0 — see every product listed under this CAS number, including other names
3-Pyridinecarboxylic anhydride, 97%, 97% (CAS 16837-38-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146E2-250mg |
| cas | 16837-38-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1408.40 Pln | |
| Chemat | 10g | 2426.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Pyridine-3-carbonyl pyridine-3-carboxylate (CAS 16837-38-0) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: pyridine-3-carbonyl pyridine-3-carboxylate. InChIKey: VPODXHOUBDCEHN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | pyridine-3-carbonyl pyridine-3-carboxylate |
| InChIKey | VPODXHOUBDCEHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)