cas: 92057-12-0 — see every product listed under this CAS number, including other names
3-Thiophen-2-yl-phenylamine, 98% (CAS 92057-12-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032152-250MG |
| cas | 92057-12-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 3699.76 Pln | |
| Fluorochem | 10g | 7005.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-thiophen-2-ylaniline (CAS 92057-12-0) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 3-thiophen-2-ylaniline. InChIKey: YUTPSMJOCLLMBK-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 3-thiophen-2-ylaniline |
| InChIKey | YUTPSMJOCLLMBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=CS2 |
Computed by PubChem (NCBI)