CAS 737000-97-4 is the registry number for (R)-(-)-1-Indanyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1R)-1-isothiocyanato-2,3-dihydro-1H-indene (CAS 737000-97-4) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: (1R)-1-isothiocyanato-2,3-dihydro-1H-indene. InChIKey: YQGGEOQEFFXRLO-SNVBAGLBSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | (1R)-1-isothiocyanato-2,3-dihydro-1H-indene |
| InChIKey | YQGGEOQEFFXRLO-SNVBAGLBSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]1N=C=S |
Computed by PubChem (NCBI)