Products 27088-83-1

CAS 27088-83-1 is the registry number for 2-(p-Tolyl)thiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g.

Structural formula: {0} (CAS {1})

2-(4-methylphenyl)-1,3-thiazole (CAS 27088-83-1) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 2-(4-methylphenyl)-1,3-thiazole. InChIKey: LHXIZCFNFNHOPM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NS
Molecular weight175.25 g/mol
IUPAC name2-(4-methylphenyl)-1,3-thiazole
InChIKeyLHXIZCFNFNHOPM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=NC=CS2

Computed by PubChem (NCBI)