CAS 62532-99-4 is the registry number for 2-(Thiophen-2-yl)aniline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-thiophen-2-ylaniline (CAS 62532-99-4) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 2-thiophen-2-ylaniline. InChIKey: IIKZLOXDTZHOAV-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 2-thiophen-2-ylaniline |
| InChIKey | IIKZLOXDTZHOAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CS2)N |
Computed by PubChem (NCBI)