CAS 70010-48-9 appears in our catalog under these names: 4-Thiophen-2-ylaniline, 98%, 4-(THIOPHEN-2-YL)ANILINE, 97%, 4-(Thiophen-2-yl)aniline, 95%, 4-(Thiophen-2-yl)aniline, 98%. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-thiophen-2-ylaniline (CAS 70010-48-9) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 4-thiophen-2-ylaniline. InChIKey: WPNWHSQJRALLBJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 4-thiophen-2-ylaniline |
| InChIKey | WPNWHSQJRALLBJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)