CAS 92057-12-0 appears in our catalog under these names: 3-(2-Thienyl)aniline, 95%, 3-Thiophen-2-yl-phenylamine, 3-(Thien-2-yl)aniline, 3-(2-Thienyl)aniline, 95%, 95%, 3-Thiophen-2-yl-phenylamine, 98%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 0,5g, 2g, 5g, 10g, 100mg.
3-thiophen-2-ylaniline (CAS 92057-12-0) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 3-thiophen-2-ylaniline. InChIKey: YUTPSMJOCLLMBK-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 3-thiophen-2-ylaniline |
| InChIKey | YUTPSMJOCLLMBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=CS2 |
Computed by PubChem (NCBI)