CAS 96919-49-2 is the registry number for 2-Thiophen-3-yl-phenylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-thiophen-3-ylaniline (CAS 96919-49-2) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 2-thiophen-3-ylaniline. InChIKey: DMPDFHZOUOIWCO-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 2-thiophen-3-ylaniline |
| InChIKey | DMPDFHZOUOIWCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC=C2)N |
Computed by PubChem (NCBI)