cas: 484-33-3 — see every product listed under this CAS number, including other names
3-hydroxy-3-(4-methoxy-1-benzofuran-5-yl)-1-phenylprop-2-en-1-one, 98% (CAS 484-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F876151-250MG |
| cas | 484-33-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 3215.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione (CAS 484-33-3) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione. InChIKey: XTLSKKJNOIMMBK-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione |
| InChIKey | XTLSKKJNOIMMBK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1C=CO2)C(=O)CC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)