CAS 29310-88-1 appears in our catalog under these names: 3–(Bromoacetyl)coumarin, 3-(Bromoacetyl)coumarin, >95.0%(GC), 3-(2-Bromoacetyl)-2H-chromen-2-one, 3-(BROMOACETYL)COUMARIN, 97%, 2H-1-BENZOPYRAN-2-ONE, 3-(2-BROMOACETYL)-, 98%, 98%. Offered by: GLPBio, TCI, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
3-(2-bromoacetyl)chromen-2-one (CAS 29310-88-1) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 3-(2-bromoacetyl)chromen-2-one. InChIKey: NTYOLVNSXVYRTJ-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 3-(2-bromoacetyl)chromen-2-one |
| InChIKey | NTYOLVNSXVYRTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)CBr |
Computed by PubChem (NCBI)