CAS 560132-24-3 appears in our catalog under these names: 3-tert-Butylphenylboronic acid, 3-tert-Butylphenylboronic acid, 98%, 3-tert-Butylphenylboronic acid, 95%, 3-tert-Butylphenylboronic acid, 98%, 98%, 3-tert-Butylbenzene boronic acid, 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 1g, 25g, 5g, 500g, 250mg, 50g.
(3-tert-butylphenyl)boronic acid (CAS 560132-24-3) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: (3-tert-butylphenyl)boronic acid. InChIKey: OKBOGYOXEDEGOG-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | (3-tert-butylphenyl)boronic acid |
| InChIKey | OKBOGYOXEDEGOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)