cas: 6665-67-4 — see every product listed under this CAS number, including other names
4',5-Dihydroxyflavone 98% (CAS 6665-67-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A540048-50mg |
| cas | 6665-67-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 203.50 Pln | |
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1199.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A540048 |
5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 6665-67-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: OKRNDQLCMXUCGG-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | OKRNDQLCMXUCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)