cas: 92-89-7 — see every product listed under this CAS number, including other names
4'-NITRO[1,1'-BIPHENYL]-4-CARBOXYLIC ACID, 98%, 98% (CAS 92-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ADE-250mg |
| cas | 92-89-7 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 256.40 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1298.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-nitrophenyl)benzoic acid (CAS 92-89-7) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(4-nitrophenyl)benzoic acid. InChIKey: LYINHPAEAYJDIR-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)benzoic acid |
| InChIKey | LYINHPAEAYJDIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)