cas: 104-04-1 — see every product listed under this CAS number, including other names
4'-Nitroacetanilide, >99.0%(GC) (CAS 104-04-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0108-25G |
| cas | 104-04-1 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 462.55 Pln | |
| TCI | 100g | 1170.64 Pln | |
| TCI | 500g | 4863.49 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
N-(4-nitrophenyl)acetamide (CAS 104-04-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(4-nitrophenyl)acetamide. InChIKey: NQRLPDFELNCFHW-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(4-nitrophenyl)acetamide |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)