cas: 104-04-1 — see every product listed under this CAS number, including other names
N-(4-Nitrophenyl)acetamide 98% (CAS 104-04-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171029-5g |
| cas | 104-04-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 654.06 Pln | |
| Ambeed | 500g | 2879.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A171029 |
N-(4-nitrophenyl)acetamide (CAS 104-04-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(4-nitrophenyl)acetamide. InChIKey: NQRLPDFELNCFHW-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(4-nitrophenyl)acetamide |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)