cas: 104-04-1 — see every product listed under this CAS number, including other names
4-Nitroacetanilide, 98%, 98% (CAS 104-04-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LUY-5g |
| cas | 104-04-1 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 500g | 1900.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 10g | 107.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(4-nitrophenyl)acetamide (CAS 104-04-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(4-nitrophenyl)acetamide. InChIKey: NQRLPDFELNCFHW-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(4-nitrophenyl)acetamide |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)