cas: 104-04-1 — see every product listed under this CAS number, including other names
4'-Nitroacetanilide, 99% (CAS 104-04-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 415750250 |
| cas | 104-04-1 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 327.85 Pln | |
| Thermo Scientific (Acros) | 100g | 939.89 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
N-(4-nitrophenyl)acetamide (CAS 104-04-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(4-nitrophenyl)acetamide. InChIKey: NQRLPDFELNCFHW-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(4-nitrophenyl)acetamide |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)