cas: 964-68-1 — see every product listed under this CAS number, including other names
4,4'-Carbonyldibenzoic acid 98% (CAS 964-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A293620-250mg |
| cas | 964-68-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A293620 |
4-(4-carboxybenzoyl)benzoic acid (CAS 964-68-1) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 4-(4-carboxybenzoyl)benzoic acid. InChIKey: LFEWXDOYPCWFHR-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 4-(4-carboxybenzoyl)benzoic acid |
| InChIKey | LFEWXDOYPCWFHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)