cas: 54628-21-6 — see every product listed under this CAS number, including other names
4,4'-Diamino-2,2'-dimethylbibenzyl, 95%, 95% (CAS 54628-21-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KEM-5g |
| cas | 54628-21-6 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1000.40 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 357.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline (CAS 54628-21-6) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline. InChIKey: ISESBQNCWCFFFR-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline |
| InChIKey | ISESBQNCWCFFFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)CCC2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)