Products 1219806-01-5
CAS 1219806-01-5 appears in our catalog under these names: 4,4'-Dichlorobenzophenone D8 100 µg/mL in Acetone, 4,4'-Dichlorobenzophenone-d8, 98 atom % D, min 98% Chemical Purity, Bis(4-chlorophenyl)methanone-d8. Offered by: Dr. Ehrenstorfer, CDN, MedChemExpress. Available pack sizes: 1,1ml, 0,25g, 0,1g, 1 mg.
Bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanone (CAS 1219806-01-5) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 259.15 g/mol. IUPAC name: bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanone. InChIKey: OKISUZLXOYGIFP-PGRXLJNUSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanone |
| InChIKey | OKISUZLXOYGIFP-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)