4,4'-Difluorobenzophenone, 99%
cas: 345-92-6 — see every product listed under this CAS number, including other names
4,4'-Difluorobenzophenone, 99% (CAS 345-92-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 50g, 250g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 151790050 |
| cas | 345-92-6 |
| size | 5g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 88.20 Pln | |
| Thermo Scientific (Acros) | 25g | 236.53 Pln | |
| Thermo Scientific (Acros) | 100g | 677.08 Pln | |
| Sigma-Aldrich | 100G | 1150.00 Pln | |
| Sigma-Aldrich | 25G | 558.00 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 50g | 133.30 Pln | |
| Fluorochem | 100g | 138.51 Pln | |
| Fluorochem | 250g | 221.81 Pln | |
| Fluorochem | 500g | 284.29 Pln | |
| Fluorochem | 1kg | 393.63 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
Bis(4-fluorophenyl)methanone (CAS 345-92-6) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: bis(4-fluorophenyl)methanone. InChIKey: LSQARZALBDFYQZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | bis(4-fluorophenyl)methanone |
| InChIKey | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)