cas: 620-93-9 — see every product listed under this CAS number, including other names
4,4'-Dimethyldiphenylamine 98% (CAS 620-93-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173472-5g |
| cas | 620-93-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A173472 |
4-methyl-N-(4-methylphenyl)aniline (CAS 620-93-9) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)aniline. InChIKey: RHPVVNRNAHRJOQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)aniline |
| InChIKey | RHPVVNRNAHRJOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)