cas: 620-93-9 — see every product listed under this CAS number, including other names
4,4'-Dimethyldiphenylamine, 98% (CAS 620-93-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 5g, 1kg, 1g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-6033-25g |
| cas | 620-93-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1kg | price on request | |
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 758.08 Pln | |
| Fluorochem | 1kg | 1205.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-methyl-N-(4-methylphenyl)aniline (CAS 620-93-9) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)aniline. InChIKey: RHPVVNRNAHRJOQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)aniline |
| InChIKey | RHPVVNRNAHRJOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)