cas: 620-93-9 — see every product listed under this CAS number, including other names
4,4'-Dimethyldiphenylamine, 98%, 98% (CAS 620-93-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144V1-5g |
| cas | 620-93-9 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 98.00 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 250g | 251.60 Pln | |
| Chemat | 1kg | 880.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-N-(4-methylphenyl)aniline (CAS 620-93-9) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)aniline. InChIKey: RHPVVNRNAHRJOQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)aniline |
| InChIKey | RHPVVNRNAHRJOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)