cas: 620-93-9 — see every product listed under this CAS number, including other names
4,4'-Dimethyldiphenylamine, 97% (CAS 620-93-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 442590050 |
| cas | 620-93-9 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 334.97 Pln | |
| Thermo Scientific (Acros) | 25g | 1020.07 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-methyl-N-(4-methylphenyl)aniline (CAS 620-93-9) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)aniline. InChIKey: RHPVVNRNAHRJOQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)aniline |
| InChIKey | RHPVVNRNAHRJOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)