cas: 331958-90-8 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(tetrahydrofuran-3-yl)-1,3,2-dioxaborolane, 97%, 97% (CAS 331958-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CIQX-100mg |
| cas | 331958-90-8 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 10g | 1202.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(oxolan-3-yl)-1,3,2-dioxaborolane (CAS 331958-90-8) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxolan-3-yl)-1,3,2-dioxaborolane. InChIKey: KEBDNHHRQNZXMA-UHFFFAOYSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxolan-3-yl)-1,3,2-dioxaborolane |
| InChIKey | KEBDNHHRQNZXMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCOC2 |
Computed by PubChem (NCBI)