cas: 599-66-6 — see every product listed under this CAS number, including other names
4,4-Sulfonylbis(methylbenzene), 98%, 98% (CAS 599-66-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PQL-100g |
| cas | 599-66-6 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 693.20 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 222.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-(4-methylphenyl)sulfonylbenzene (CAS 599-66-6) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)sulfonylbenzene. InChIKey: WEAYCYAIVOIUMG-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)sulfonylbenzene |
| InChIKey | WEAYCYAIVOIUMG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)