CAS 869950-38-9 is the registry number for 4-((3,5-Dimethylphenoxy)methyl)thiophene-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3,5-dimethylphenoxy)methyl]thiophene-2-carbaldehyde (CAS 869950-38-9) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 4-[(3,5-dimethylphenoxy)methyl]thiophene-2-carbaldehyde. InChIKey: WBRNZVXTSYFPPW-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 4-[(3,5-dimethylphenoxy)methyl]thiophene-2-carbaldehyde |
| InChIKey | WBRNZVXTSYFPPW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OCC2=CSC(=C2)C=O)C |
Computed by PubChem (NCBI)