CAS 599-66-6 appears in our catalog under these names: Di-p-tolyl sulfone, 98%, Di–p–tolyl sulfone, Bis(4-methylphenyl) sulfone, 4,4-Sulfonylbis(methylbenzene), 98%, 98%, P-TOLYL SULFONE, 99%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: 1g, 25g, 100g, 5g, 250g, 10g, 500g.
1-methyl-4-(4-methylphenyl)sulfonylbenzene (CAS 599-66-6) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)sulfonylbenzene. InChIKey: WEAYCYAIVOIUMG-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)sulfonylbenzene |
| InChIKey | WEAYCYAIVOIUMG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)