CAS 4212-74-2 appears in our catalog under these names: Benzene, 2,4-dimethyl-1-(phenylsulfonyl)-, 95%, 2,4-Dimethyl-1-(phenylsulfonyl)benzene, 98%, 2,4-Dimethyldiphenyl sulfone, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1-(benzenesulfonyl)-2,4-dimethylbenzene (CAS 4212-74-2) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 1-(benzenesulfonyl)-2,4-dimethylbenzene. InChIKey: ZCVSDPUSEUOUHQ-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2,4-dimethylbenzene |
| InChIKey | ZCVSDPUSEUOUHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)