CAS 24197-34-0 appears in our catalog under these names: Bis(4-hydroxy-3-methylphenyl) sulfide, 98%, Bis(4-hydroxy-3-methylphenyl) Sulfide, >98.0%(GC), 4,4'-Thiobis(2-methylphenol), 98%, 98%, 4,4'-Thiobis(2-methylphenol), 4,4'-Thiobis(2-methylphenol), 98%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 5g, 100g, 500g.
4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol (CAS 24197-34-0) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol. InChIKey: IBNFPRMKLZDANU-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol |
| InChIKey | IBNFPRMKLZDANU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SC2=CC(=C(C=C2)O)C)O |
Computed by PubChem (NCBI)