Products 25195-40-8
CAS 25195-40-8 is the registry number for Methylsulfonyldiphenylmethane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[methylsulfonyl(phenyl)methyl]benzene (CAS 25195-40-8) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: [methylsulfonyl(phenyl)methyl]benzene. InChIKey: JWZJLQFATOGURI-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | [methylsulfonyl(phenyl)methyl]benzene |
| InChIKey | JWZJLQFATOGURI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)