Products 413574-94-4

CAS 413574-94-4 is the registry number for [5-(2-Phenylethyl)-2-thienyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[5-(2-phenylethyl)thiophen-2-yl]acetic acid (CAS 413574-94-4) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 2-[5-(2-phenylethyl)thiophen-2-yl]acetic acid. InChIKey: TUUNBULLUWGHRG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O2S
Molecular weight246.33 g/mol
IUPAC name2-[5-(2-phenylethyl)thiophen-2-yl]acetic acid
InChIKeyTUUNBULLUWGHRG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC2=CC=C(S2)CC(=O)O

Computed by PubChem (NCBI)