cas: 23834-01-7 — see every product listed under this CAS number, including other names
4,5,7-Trichloroquinoline, 95+% (CAS 23834-01-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A156309-1g |
| cas | 23834-01-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6163.36 Pln | |
| AmBeed | 5g | 24443.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,5,7-trichloroquinoline (CAS 23834-01-7) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 4,5,7-trichloroquinoline. InChIKey: WWFMSYKATMDLJP-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 4,5,7-trichloroquinoline |
| InChIKey | WWFMSYKATMDLJP-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=C(C2=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)