cas: 401622-74-0 — see every product listed under this CAS number, including other names
4,5-DIHYDRONAPHTHO[2,1-D][1,3]THIAZOL-2-AMINE, 95%, 95% (CAS 401622-74-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C6ZD-100mg |
| cas | 401622-74-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1806.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine (CAS 401622-74-0) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine. InChIKey: NBJZFXQLZREGNR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine |
| InChIKey | NBJZFXQLZREGNR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)SC(=N2)N |
Computed by PubChem (NCBI)