cas: 1217800-70-8 — see every product listed under this CAS number, including other names
4,5-Dichloro-2-fluorobenzaldehyde, 97%, 97% (CAS 1217800-70-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126Z4-100mg |
| cas | 1217800-70-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 899.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,5-dichloro-2-fluorobenzaldehyde (CAS 1217800-70-8) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 4,5-dichloro-2-fluorobenzaldehyde. InChIKey: OXEVLIPBDBFQBA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 4,5-dichloro-2-fluorobenzaldehyde |
| InChIKey | OXEVLIPBDBFQBA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)F)C=O |
Computed by PubChem (NCBI)