cas: 1217800-70-8 — see every product listed under this CAS number, including other names
4,5-Dichloro-2-fluorobenzaldehyde, 97% (CAS 1217800-70-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624532-100MG |
| cas | 1217800-70-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 612.30 Pln | |
| Fluorochem | 1g | 1466.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,5-dichloro-2-fluorobenzaldehyde (CAS 1217800-70-8) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 4,5-dichloro-2-fluorobenzaldehyde. InChIKey: OXEVLIPBDBFQBA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 4,5-dichloro-2-fluorobenzaldehyde |
| InChIKey | OXEVLIPBDBFQBA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)F)C=O |
Computed by PubChem (NCBI)