cas: 34176-49-3 — see every product listed under this CAS number, including other names
4,5-Dihydronaphtho[1,2-d]thiazol-2-ylamine, 95% (CAS 34176-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034983-1G |
| cas | 34176-49-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1752.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine (CAS 34176-49-3) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine. InChIKey: RKFXIXZWTWCVBR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
| InChIKey | RKFXIXZWTWCVBR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)N=C(S2)N |
Computed by PubChem (NCBI)