4,5-Dinitrobenzene-1,2-diamine, 95%
cas: 32690-28-1 — see every product listed under this CAS number, including other names
4,5-Dinitrobenzene-1,2-diamine, 95% (CAS 32690-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A539594-100mg |
| cas | 32690-28-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 793.12 Pln | |
| Ambeed | 250mg | 1126.88 Pln | |
| Ambeed | 1g | 3307.38 Pln | |
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 1g | 2426.00 Pln | |
| BLDpharm | 100mg | 853.06 Pln | |
| BLDpharm | 250mg | 1208.49 Pln | |
| BLDpharm | 1g | 3246.66 Pln | |
| Fluorochem | 100mg | 810.15 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 3111.42 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,5-dinitrobenzene-1,2-diamine (CAS 32690-28-1) is a chemical compound with the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. IUPAC name: 4,5-dinitrobenzene-1,2-diamine. InChIKey: PCSIZKSNIWJKSK-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O4 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 4,5-dinitrobenzene-1,2-diamine |
| InChIKey | PCSIZKSNIWJKSK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])[N+](=O)[O-])N)N |
Computed by PubChem (NCBI)
Synonyms:
4,5-dinitrobenzene-1,2-diamine, 1,2-Benzenediamine, 4,5-dinitro-, 1,2-diamino-4,5-dinitrobenzene, 4,5-Dinitro-1,2-benzenediamine, 4,5-dinitro-o-phenylenediamine, 1,2-Dinitro-4,5-diaminobenzene, 4,5-Dinitro-benzene-1,2-diamine, 4,5-dinitro-1,2-phenylene-diamine, 4,5-Dinitro-1,2-benzenediamine #